Difference between revisions of "23S-rRNA-pseudouridine1915"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8343 == * common-name: ** 1-16:0-2-lysophosphatidylcholine * smiles: ** cccccccccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * inchi...") |
(Created page with "Category:metabolite == Metabolite CPD-824 == * common-name: ** 5-guanidino-2-oxopentanoate * smiles: ** c(c(cccnc(=[n+])n)=o)(=o)[o-] * inchi-key: ** arbhxjxxvvhmet-uhfffa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-824 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-guanidino-2-oxopentanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(cccnc(=[n+])n)=o)(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** arbhxjxxvvhmet-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 173.171 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ARG-OXIDATION-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-guanidino-2-oxopentanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=173.171}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-824
- common-name:
- 5-guanidino-2-oxopentanoate
- smiles:
- c(c(cccnc(=[n+])n)=o)(=o)[o-]
- inchi-key:
- arbhxjxxvvhmet-uhfffaoysa-n
- molecular-weight:
- 173.171
