Difference between revisions of "23S-rRNA-pseudouridine2605"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] * inchi-key: ** cbidrcwhncksto-...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-pseudouridine2605 == * common-name: ** a pseudouridine2605 in 23s rrna == Reaction(s) known to consume the compound == == Reacti...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23S-rRNA-pseudouridine2605 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a pseudouridine2605 in 23s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11836]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a pseudouridine2605 in 23s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 23S-rRNA-pseudouridine2605
- common-name:
- a pseudouridine2605 in 23s rrna
