Difference between revisions of "23S-rRNA-pseudouridine955-2504-2580"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METHIONINE-SYNTHASE-METHYLCOBALAMIN == * common-name: ** a [methionine synthase]-methylcob(i)alamin == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * smiles: ** c(cc(c(=o)[o-])[n+])onc(n)=o * inchi-key: ** sfyvzosiaizwqu-vk...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METHIONINE-SYNTHASE-METHYLCOBALAMIN ==
+
== Metabolite O-UREIDOHOMOSERINE ==
 
* common-name:
 
* common-name:
** a [methionine synthase]-methylcob(i)alamin
+
** o-ureido-l-homoserine
 +
* smiles:
 +
** c(cc(c(=o)[o-])[n+])onc(n)=o
 +
* inchi-key:
 +
** sfyvzosiaizwqu-vkhmyheasa-n
 +
* molecular-weight:
 +
** 177.16
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.135-RXN]]
+
* [[RXN-10]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [methionine synthase]-methylcob(i)alamin}}
+
{{#set: common-name=o-ureido-l-homoserine}}
 +
{{#set: inchi-key=inchikey=sfyvzosiaizwqu-vkhmyheasa-n}}
 +
{{#set: molecular-weight=177.16}}

Revision as of 11:14, 15 January 2021

Metabolite O-UREIDOHOMOSERINE

  • common-name:
    • o-ureido-l-homoserine
  • smiles:
    • c(cc(c(=o)[o-])[n+])onc(n)=o
  • inchi-key:
    • sfyvzosiaizwqu-vkhmyheasa-n
  • molecular-weight:
    • 177.16

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality