Difference between revisions of "23S-rRNA-pseudouridine955-2504-2580"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * smiles: ** c(cc(c(=o)[o-])[n+])onc(n)=o * inchi-key: ** sfyvzosiaizwqu-vk...") |
(Created page with "Category:metabolite == Metabolite K+ == * common-name: ** k+ * smiles: ** [k+] * inchi-key: ** npypahlbtdxsss-uhfffaoysa-n * molecular-weight: ** 39.098 == Reaction(s) kno...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite K+ == |
* common-name: | * common-name: | ||
− | ** | + | ** k+ |
* smiles: | * smiles: | ||
− | ** | + | ** [k+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** npypahlbtdxsss-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 39.098 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[3.6.3.12-RXN]] |
+ | * [[3.6.3.9-RXN]] | ||
+ | * [[ExchangeSeed-K+]] | ||
+ | * [[TRANS-RXN-2]] | ||
+ | * [[TransportSeed-K+]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3.6.3.12-RXN]] |
+ | * [[3.6.3.9-RXN]] | ||
+ | * [[ExchangeSeed-K+]] | ||
+ | * [[TRANS-RXN-2]] | ||
+ | * [[TransportSeed-K+]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=k+}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npypahlbtdxsss-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=39.098}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite K+
- common-name:
- k+
- smiles:
- [k+]
- inchi-key:
- npypahlbtdxsss-uhfffaoysa-n
- molecular-weight:
- 39.098