Difference between revisions of "23S-rRNA-uracil-1939"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MPBQ == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uracil-1939 == * common-name: ** a uracil1939 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11601 == Rea...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23S-rRNA-uracil-1939 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a uracil1939 in 23s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11601]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a uracil1939 in 23s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 23S-rRNA-uracil-1939
- common-name:
- a uracil1939 in 23s rrna
