Difference between revisions of "23S-rRNA-uracil-1939"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11757 == * transcription-direction: ** positive * right-end-position: ** 303400 * left-end-position: ** 294592 * centisome-position: ** 80.2327...") |
(Created page with "Category:metabolite == Metabolite CPD-13670 == * common-name: ** 30-hydroxy-11-oxo-β-amyrin * smiles: ** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13670 == |
− | * | + | * common-name: |
− | ** | + | ** 30-hydroxy-11-oxo-β-amyrin |
− | * | + | * smiles: |
− | ** | + | ** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c |
− | * | + | * inchi-key: |
− | ** | + | ** jcgxiyqlryphdg-zbyjljtqsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 456.707 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-13493]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13492]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=30-hydroxy-11-oxo-β-amyrin}} | |
− | + | {{#set: inchi-key=inchikey=jcgxiyqlryphdg-zbyjljtqsa-n}} | |
− | + | {{#set: molecular-weight=456.707}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-13670
- common-name:
- 30-hydroxy-11-oxo-β-amyrin
- smiles:
- cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c
- inchi-key:
- jcgxiyqlryphdg-zbyjljtqsa-n
- molecular-weight:
- 456.707