Difference between revisions of "23S-rRNA-uracil-1939"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13670 == * common-name: ** 30-hydroxy-11-oxo-β-amyrin * smiles: ** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c...")
(Created page with "Category:metabolite == Metabolite NITRATE == * common-name: ** nitrate * smiles: ** n(=o)(=o)[o-] * inchi-key: ** nhnbfggvmkefgy-uhfffaoysa-n * molecular-weight: ** 62.005...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13670 ==
+
== Metabolite NITRATE ==
 
* common-name:
 
* common-name:
** 30-hydroxy-11-oxo-β-amyrin
+
** nitrate
 
* smiles:
 
* smiles:
** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c
+
** n(=o)(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** jcgxiyqlryphdg-zbyjljtqsa-n
+
** nhnbfggvmkefgy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 456.707
+
** 62.005
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13493]]
+
* [[ExchangeSeed-NITRATE]]
 +
* [[NITRATE-REDUCTASE-NADH-RXN]]
 +
* [[NITRATE-REDUCTASE-NADPH-RXN]]
 +
* [[NITRATE-REDUCTASE-NADPORNOPH-RXN]]
 +
* [[NITRATREDUCT-RXN]]
 +
* [[NO3t]]
 +
* [[TCV3]]
 +
* [[TransportSeed-NITRATE]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13492]]
+
* [[ExchangeSeed-NITRATE]]
 +
* [[NITRATREDUCT-RXN]]
 +
* [[NO3t]]
 +
* [[NODOx]]
 +
* [[NODOy]]
 +
* [[R621-RXN]]
 +
* [[TCV3]]
 +
* [[TransportSeed-NITRATE]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=30-hydroxy-11-oxo-β-amyrin}}
+
{{#set: common-name=nitrate}}
{{#set: inchi-key=inchikey=jcgxiyqlryphdg-zbyjljtqsa-n}}
+
{{#set: inchi-key=inchikey=nhnbfggvmkefgy-uhfffaoysa-n}}
{{#set: molecular-weight=456.707}}
+
{{#set: molecular-weight=62.005}}

Revision as of 14:53, 5 January 2021

Metabolite NITRATE

  • common-name:
    • nitrate
  • smiles:
    • n(=o)(=o)[o-]
  • inchi-key:
    • nhnbfggvmkefgy-uhfffaoysa-n
  • molecular-weight:
    • 62.005

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality