Difference between revisions of "23S-rRNA-uracil-1939"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NITRATE == * common-name: ** nitrate * smiles: ** n(=o)(=o)[o-] * inchi-key: ** nhnbfggvmkefgy-uhfffaoysa-n * molecular-weight: ** 62.005...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-HYDROXY-L-KYNURENINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-hydroxy-l-kynurenine |
* smiles: | * smiles: | ||
− | ** n(=o)(=o) | + | ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vckpuufaignjhc-lurjtmiesa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 224.216 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10721]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] |
− | + | * [[RXN-10721]] | |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-hydroxy-l-kynurenine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vckpuufaignjhc-lurjtmiesa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.216}} |
Revision as of 15:24, 5 January 2021
Contents
Metabolite 3-HYDROXY-L-KYNURENINE
- common-name:
- 3-hydroxy-l-kynurenine
- smiles:
- c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
- inchi-key:
- vckpuufaignjhc-lurjtmiesa-n
- molecular-weight:
- 224.216