Difference between revisions of "23S-rRNA-uracil-1939"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite RNASE-II-DEGRADATION-SUBSTRATE-MRNA == * common-name: ** rnase ii degradation substrate mrna == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RNASE-II-DEGRADATION-SUBSTRATE-MRNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** rnase ii degradation substrate mrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.1.13.1-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=rnase ii degradation substrate mrna}} |
| − | |||
| − | |||
Revision as of 13:07, 14 January 2021
Contents
Metabolite RNASE-II-DEGRADATION-SUBSTRATE-MRNA
- common-name:
- rnase ii degradation substrate mrna
