Difference between revisions of "23S-rRNA-uracil-1939"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RNASE-II-DEGRADATION-SUBSTRATE-MRNA == * common-name: ** rnase ii degradation substrate mrna == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite MPBQ == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MPBQ == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methyl-6-phytyl-1,4-benzoquinol |
| + | * smiles: | ||
| + | ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c | ||
| + | * inchi-key: | ||
| + | ** gtwcnyrfozkwtl-uofxaseasa-n | ||
| + | * molecular-weight: | ||
| + | ** 402.659 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-2542]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-2541]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}} |
| + | {{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}} | ||
| + | {{#set: molecular-weight=402.659}} | ||
Revision as of 18:52, 14 January 2021
Contents
Metabolite MPBQ
- common-name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- smiles:
- cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
- inchi-key:
- gtwcnyrfozkwtl-uofxaseasa-n
- molecular-weight:
- 402.659
