Difference between revisions of "23S-rRNA-uridine1911-1915-1917"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol 4-phosphate * smiles: ** cc(o)(co)c(o)cop([o-])([o-])=o...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine1911-1915-1917 == * common-name: ** a 23s rrna uridine1911/1915/1917 == Reaction(s) known to consume the compound == * ...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE ==
+
== Metabolite 23S-rRNA-uridine1911-1915-1917 ==
 
* common-name:
 
* common-name:
** 2-c-methyl-d-erythritol 4-phosphate
+
** a 23s rrna uridine1911/1915/1917
* smiles:
 
** cc(o)(co)c(o)cop([o-])([o-])=o
 
* inchi-key:
 
** xmwhrvnvkdkbrg-uhnvwzdzsa-l
 
* molecular-weight:
 
** 214.111
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.60-RXN]]
+
* [[RXN-11837]]
* [[DXPREDISOM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DXPREDISOM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-c-methyl-d-erythritol 4-phosphate}}
+
{{#set: common-name=a 23s rrna uridine1911/1915/1917}}
{{#set: inchi-key=inchikey=xmwhrvnvkdkbrg-uhnvwzdzsa-l}}
 
{{#set: molecular-weight=214.111}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 23S-rRNA-uridine1911-1915-1917

  • common-name:
    • a 23s rrna uridine1911/1915/1917

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality