Difference between revisions of "23S-rRNA-uridine2457"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine2457 == * common-name: ** uridine2457 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11834 == Reac...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23S-rRNA-uridine2457 == |
* common-name: | * common-name: | ||
| − | ** | + | ** uridine2457 in 23s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11834]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=uridine2457 in 23s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 23S-rRNA-uridine2457
- common-name:
- uridine2457 in 23s rrna
