Difference between revisions of "23S-rRNA-uridine2605"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine2605 == * common-name: ** uridine2605 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11836 == Reac...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23S-rRNA-uridine2605 == |
* common-name: | * common-name: | ||
| − | ** | + | ** uridine2605 in 23s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11836]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=uridine2605 in 23s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 23S-rRNA-uridine2605
- common-name:
- uridine2605 in 23s rrna
