Difference between revisions of "23S-rRNA-uridine746"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7496 == * common-name: ** prolycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine746 == * common-name: ** uridine746 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11843 == Reacti...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23S-rRNA-uridine746 == |
* common-name: | * common-name: | ||
| − | ** | + | ** uridine746 in 23s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11843]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=uridine746 in 23s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 23S-rRNA-uridine746
- common-name:
- uridine746 in 23s rrna
