Difference between revisions of "23S-rRNA-uridine746"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-LACTOYL-GLUTATHIONE == * common-name: ** (r)-s-lactoylglutathione * smiles: ** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o...")
(Created page with "Category:metabolite == Metabolite CPD-14900 == * common-name: ** porifersta-5,7-dienol * smiles: ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-LACTOYL-GLUTATHIONE ==
+
== Metabolite CPD-14900 ==
 
* common-name:
 
* common-name:
** (r)-s-lactoylglutathione
+
** porifersta-5,7-dienol
 
* smiles:
 
* smiles:
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** vdydcvuwiliyqf-csmhccousa-m
+
** arvgmiswlzpbch-wgdhxtrrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 378.376
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYOXI-RXN]]
 
* [[GLYOXII-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYOXI-RXN]]
+
* [[RXN-13892]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-s-lactoylglutathione}}
+
{{#set: common-name=porifersta-5,7-dienol}}
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
+
{{#set: inchi-key=inchikey=arvgmiswlzpbch-wgdhxtrrsa-n}}
{{#set: molecular-weight=378.376}}
+
{{#set: molecular-weight=412.698}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-14900

  • common-name:
    • porifersta-5,7-dienol
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • arvgmiswlzpbch-wgdhxtrrsa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality