Difference between revisions of "23S-rRNA-uridine955-2504-2580"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Unsulfurated-Sulfur-Acceptors == * common-name: ** an unsulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * R...")
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Unsulfurated-Sulfur-Acceptors ==
+
== Metabolite ADENOSYL-P4 ==
 
* common-name:
 
* common-name:
** an unsulfurated [sulfur carrier]
+
** 5',5'''-diadenosine tetraphosphate
 +
* smiles:
 +
** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
 +
* inchi-key:
 +
** yoahknvsncmzgq-xpwfqurosa-j
 +
* molecular-weight:
 +
** 832.36
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12587]]
+
* [[3.6.1.41-RXN]]
* [[RXN-12588]]
+
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.8.1.6-RXN]]
+
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
* [[RXN-12587]]
 
* [[RXN-14480]]
 
* [[RXN-14950]]
 
* [[RXN-14957]]
 
* [[RXN-14959]]
 
* [[RXN-17472]]
 
* [[RXN0-5063]]
 
* [[RXN0-6359]]
 
* [[RXN0-949]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an unsulfurated [sulfur carrier]}}
+
{{#set: common-name=5',5'''-diadenosine tetraphosphate}}
 +
{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
 +
{{#set: molecular-weight=832.36}}

Revision as of 14:56, 5 January 2021

Metabolite ADENOSYL-P4

  • common-name:
    • 5',5-diadenosine tetraphosphate
  • smiles:
    • c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
  • inchi-key:
    • yoahknvsncmzgq-xpwfqurosa-j
  • molecular-weight:
    • 832.36

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality