Difference between revisions of "23S-rRNA-uridine955-2504-2580"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Unsulfurated-Sulfur-Acceptors == * common-name: ** an unsulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * R...") |
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ADENOSYL-P4 == |
* common-name: | * common-name: | ||
− | ** | + | ** 5',5'''-diadenosine tetraphosphate |
+ | * smiles: | ||
+ | ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o | ||
+ | * inchi-key: | ||
+ | ** yoahknvsncmzgq-xpwfqurosa-j | ||
+ | * molecular-weight: | ||
+ | ** 832.36 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[3.6.1.41-RXN]] |
− | * [[RXN | + | * [[ATP-ADENYLYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ATP-ADENYLYLTRANSFERASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5',5'''-diadenosine tetraphosphate}} |
+ | {{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}} | ||
+ | {{#set: molecular-weight=832.36}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite ADENOSYL-P4
- common-name:
- 5',5-diadenosine tetraphosphate
- smiles:
- c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
- inchi-key:
- yoahknvsncmzgq-xpwfqurosa-j
- molecular-weight:
- 832.36