Difference between revisions of "23S-rRNA-uridine955-2504-2580"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** zwiadyzpowu...") |
(Created page with "Category:metabolite == Metabolite Pro-tRNA-2-O-MeCytidine4 == * common-name: ** a 2'-o-methylcytidine4 in trnapro == Reaction(s) known to consume the compound == == Reacti...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Pro-tRNA-2-O-MeCytidine4 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 2'-o-methylcytidine4 in trnapro |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-12477]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 2'-o-methylcytidine4 in trnapro}} |
− | |||
− |
Revision as of 13:09, 14 January 2021
Contents
Metabolite Pro-tRNA-2-O-MeCytidine4
- common-name:
- a 2'-o-methylcytidine4 in trnapro