Difference between revisions of "24-26-N-linked-Glycan"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc=c(o)1) * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa...") |
(Created page with "Category:metabolite == Metabolite Carboxylic-esters == * common-name: ** a carboxylic ester == Reaction(s) known to consume the compound == * CARBOXYLESTERASE-RXN == R...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Carboxylic-esters == |
* common-name: | * common-name: | ||
− | ** | + | ** a carboxylic ester |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CARBOXYLESTERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a carboxylic ester}} |
− | |||
− |
Revision as of 14:54, 5 January 2021
Contents
Metabolite Carboxylic-esters
- common-name:
- a carboxylic ester