Difference between revisions of "24-26-N-linked-Glycan"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17858 == * transcription-direction: ** positive * right-end-position: ** 568496 * left-end-position: ** 543289 * centisome-position: ** 81.59060...")
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc=c(o)1) * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17858 ==
+
== Metabolite CONIFERYL-ALDEHYDE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** coniferaldehyde
−
* right-end-position:
+
* smiles:
−
** 568496
+
** coc1(=cc(c=cc=o)=cc=c(o)1)
−
* left-end-position:
+
* inchi-key:
−
** 543289
+
** dkzbbwmurdfhne-nscuhmnnsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 81.59060   
+
** 178.187
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-1106]]
−
* [[ATPASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=coniferaldehyde}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}}
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
{{#set: molecular-weight=178.187}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=568496}}
 
−
{{#set: left-end-position=543289}}
 
−
{{#set: centisome-position=81.59060    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:31, 18 December 2020

Metabolite CONIFERYL-ALDEHYDE

  • common-name:
    • coniferaldehyde
  • smiles:
    • coc1(=cc(c=cc=o)=cc=c(o)1)
  • inchi-key:
    • dkzbbwmurdfhne-nscuhmnnsa-n
  • molecular-weight:
    • 178.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=24-26-N-linked-Glycan&oldid=46067"