Difference between revisions of "25S-rRNA-N1-methyladenine-2142"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UMPP UMPP] == * direction: ** left-to-right * common-name: ** uridine 5'-monophosphate phosphohydro...")
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) * inchi-key...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UMPP UMPP] ==
+
== Metabolite BETA-TOCOPHEROL ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** uridine 5'-monophosphate phosphohydrolase
+
** β-tocopherol
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[UMP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[URIDINE]][c]
+
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c))
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ04587]]
+
** wgvkwnupngfdfj-dqczwyhmsa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 416.686
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-2562]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=β-tocopherol}}
−
{{#set: common-name=uridine 5'-monophosphate phosphohydrolase}}
+
{{#set: inchi-key=inchikey=wgvkwnupngfdfj-dqczwyhmsa-n}}
−
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=416.686}}
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:36, 18 December 2020

Metabolite BETA-TOCOPHEROL

  • common-name:
    • β-tocopherol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c))
  • inchi-key:
    • wgvkwnupngfdfj-dqczwyhmsa-n
  • molecular-weight:
    • 416.686

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=25S-rRNA-N1-methyladenine-2142&oldid=48012"