Difference between revisions of "25S-rRNA-adenine-2142"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14875 == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) * inchi...") |
(Created page with "Category:metabolite == Metabolite 25S-rRNA-adenine-2142 == * common-name: ** adenine2142 in 25s rrna == Reaction(s) known to consume the compound == * RXN-14549 == Rea...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 25S-rRNA-adenine-2142 == |
* common-name: | * common-name: | ||
− | ** | + | ** adenine2142 in 25s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14549]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adenine2142 in 25s rrna}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite 25S-rRNA-adenine-2142
- common-name:
- adenine2142 in 25s rrna