Difference between revisions of "2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SUMO-peptides == * common-name: ** a mature small ubiquitin-like modifier (sumo) peptide == Reaction(s) known to consume the compound ==...")
(Created page with "Category:metabolite == Metabolite CPD-19172 == * common-name: ** (2e,9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SUMO-peptides ==
+
== Metabolite CPD-19172 ==
 
* common-name:
 
* common-name:
** a mature small ubiquitin-like modifier (sumo) peptide
+
** (2e,9z)-octadecenoyl-coa
 +
* smiles:
 +
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** reoymonhghuley-ppsvnwdxsa-j
 +
* molecular-weight:
 +
** 1025.937
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17776]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.22.68-RXN]]
+
* [[RXN-17775]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a mature small ubiquitin-like modifier (sumo) peptide}}
+
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}
 +
{{#set: molecular-weight=1025.937}}

Revision as of 18:59, 14 January 2021

Metabolite CPD-19172

  • common-name:
    • (2e,9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • reoymonhghuley-ppsvnwdxsa-j
  • molecular-weight:
    • 1025.937

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality