Difference between revisions of "2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.19.1-RXN 1.14.19.1-RXN] == * direction: ** left-to-right * common-name: ** stearoyl-coa 9-desa...")
(Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * smiles: ** cc1(co)(op(=o)([o-])...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.19.1-RXN 1.14.19.1-RXN] ==
+
== Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** stearoyl-coa 9-desaturase
+
** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.1 ec-1.14.19.1]
+
** cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[STEAROYL-COA]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[OLEOYL-COA]][c] '''+''' 2 [[WATER]][c]
+
** sfrqrnjmiiuydi-uhnvwzdzsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04243]]
+
** 276.076
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[HDS]]
−
* Gene: [[SJ14681]]
+
* [[RXN-15878]]
−
** Category: [[annotation]]
+
* [[RXN0-882]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ01253]]
+
* [[HDS]]
−
** Category: [[annotation]]
+
* [[RXN0-302]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=2-c-methyl-d-erythritol-2,4-cyclodiphosphate}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=sfrqrnjmiiuydi-uhnvwzdzsa-l}}
−
* Gene: [[SJ09228]]
+
{{#set: molecular-weight=276.076}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-5996]], oleate biosynthesis II (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5996 PWY-5996]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19722 19722]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02222 R02222]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=stearoyl-coa 9-desaturase}}
 
−
{{#set: ec-number=ec-1.14.19.1}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE

  • common-name:
    • 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
  • smiles:
    • cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)
  • inchi-key:
    • sfrqrnjmiiuydi-uhnvwzdzsa-l
  • molecular-weight:
    • 276.076

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE&oldid=139724"