Difference between revisions of "2E-11Z-icosa-2-11-dienoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17541 == * common-name: ** dapdiamide c * smiles: ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** mjpkmdapfrgjgv-f...") |
(Created page with "Category:metabolite == Metabolite 2E-11Z-icosa-2-11-dienoyl-ACPs == * common-name: ** an (2e,11z)-icosa-2,11-dienoyl-[acp] == Reaction(s) known to consume the compound ==...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2E-11Z-icosa-2-11-dienoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an (2e,11z)-icosa-2,11-dienoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16632]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16631]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an (2e,11z)-icosa-2,11-dienoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 2E-11Z-icosa-2-11-dienoyl-ACPs
- common-name:
- an (2e,11z)-icosa-2,11-dienoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an (2e,11z)-icosa-2,11-dienoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
