Difference between revisions of "2E-11Z-icosa-2-11-dienoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...")
(Created page with "Category:metabolite == Metabolite 2E-11Z-icosa-2-11-dienoyl-ACPs == * common-name: ** an (2e,11z)-icosa-2,11-dienoyl-[acp] == Reaction(s) known to consume the compound ==...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALPHA-D-GALACTOSE ==
+
== Metabolite 2E-11Z-icosa-2-11-dienoyl-ACPs ==
 
* common-name:
 
* common-name:
** α-d-galactose
+
** an (2e,11z)-icosa-2,11-dienoyl-[acp]
* smiles:
 
** c(o)c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
** wqzgkkkjijffok-phyprbdbsa-n
 
* molecular-weight:
 
** 180.157
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALDOSE1EPIM-RXN]]
+
* [[RXN-16632]]
* [[GALACTOKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALDOSE1EPIM-RXN]]
+
* [[RXN-16631]]
* [[GALACTOKIN-RXN]]
 
* [[RXN-11501]]
 
* [[RXN-11502]]
 
* [[RXN-12088]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-galactose}}
+
{{#set: common-name=an (2e,11z)-icosa-2,11-dienoyl-[acp]}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
 
{{#set: molecular-weight=180.157}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 2E-11Z-icosa-2-11-dienoyl-ACPs

  • common-name:
    • an (2e,11z)-icosa-2,11-dienoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an (2e,11z)-icosa-2,11-dienoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.