Difference between revisions of "2E-11Z-icosa-2-11-dienoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...")
(Created page with "Category:metabolite == Metabolite Nucleoside-Monophosphates == * common-name: ** a nucleoside 5'-monophosphate == Reaction(s) known to consume the compound == * RXN-1447...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALPHA-D-GALACTOSE ==
+
== Metabolite Nucleoside-Monophosphates ==
 
* common-name:
 
* common-name:
** α-d-galactose
+
** a nucleoside 5'-monophosphate
* smiles:
 
** c(o)c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
** wqzgkkkjijffok-phyprbdbsa-n
 
* molecular-weight:
 
** 180.157
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALDOSE1EPIM-RXN]]
+
* [[RXN-14473]]
* [[GALACTOKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALDOSE1EPIM-RXN]]
+
* [[3.1.13.1-RXN]]
* [[GALACTOKIN-RXN]]
+
* [[3.1.26.4-RXN]]
* [[RXN-11501]]
+
* [[3.1.4.1-RXN]]
* [[RXN-11502]]
+
* [[3.1.4.17-RXN]]
* [[RXN-12088]]
+
* [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
 +
* [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
 +
* [[RXN-14024]]
 +
* [[RXN0-4961]]
 +
* [[RXN0-6479]]
 +
* [[RXN0-6525]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-galactose}}
+
{{#set: common-name=a nucleoside 5'-monophosphate}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
 
{{#set: molecular-weight=180.157}}
 

Revision as of 13:11, 14 January 2021

Metabolite Nucleoside-Monophosphates

  • common-name:
    • a nucleoside 5'-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality