Difference between revisions of "2E-11Z-icosa-2-11-dienoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-23709 == == Reaction(s) known to consume the compound == * RXN-21831 == Reaction(s) known to produce the compound == * RXN-2183...") |
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ALPHA-D-GALACTOSE == |
+ | * common-name: | ||
+ | ** α-d-galactose | ||
+ | * smiles: | ||
+ | ** c(o)c1(oc(o)c(o)c(o)c(o)1) | ||
+ | * inchi-key: | ||
+ | ** wqzgkkkjijffok-phyprbdbsa-n | ||
+ | * molecular-weight: | ||
+ | ** 180.157 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ALDOSE1EPIM-RXN]] |
+ | * [[GALACTOKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ALDOSE1EPIM-RXN]] |
+ | * [[GALACTOKIN-RXN]] | ||
+ | * [[RXN-11501]] | ||
+ | * [[RXN-11502]] | ||
+ | * [[RXN-12088]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=α-d-galactose}} | ||
+ | {{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}} | ||
+ | {{#set: molecular-weight=180.157}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite ALPHA-D-GALACTOSE
- common-name:
- α-d-galactose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-phyprbdbsa-n
- molecular-weight:
- 180.157