Difference between revisions of "2E-7Z-hexadeca-2-7-dienoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15656 == * common-name: ** (3e)-undec-2-enoyl-coa * smiles: ** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
(Created page with "Category:metabolite == Metabolite CPD-15699 == * common-name: ** aldehydo-l-arabinose * smiles: ** [ch](=o)c(o)c(o)c(o)co * inchi-key: ** pymyphuhkuwmla-vayjurfesa-n * mol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15656 ==
+
== Metabolite CPD-15699 ==
 
* common-name:
 
* common-name:
** (3e)-undec-2-enoyl-coa
+
** aldehydo-l-arabinose
 
* smiles:
 
* smiles:
** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [ch](=o)c(o)c(o)c(o)co
 
* inchi-key:
 
* inchi-key:
** cavmkinpgrcurl-phhhidlgsa-j
+
** pymyphuhkuwmla-vayjurfesa-n
 
* molecular-weight:
 
* molecular-weight:
** 929.765
+
** 150.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14778]]
+
* [[RXN-14102]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14102]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3e)-undec-2-enoyl-coa}}
+
{{#set: common-name=aldehydo-l-arabinose}}
{{#set: inchi-key=inchikey=cavmkinpgrcurl-phhhidlgsa-j}}
+
{{#set: inchi-key=inchikey=pymyphuhkuwmla-vayjurfesa-n}}
{{#set: molecular-weight=929.765}}
+
{{#set: molecular-weight=150.131}}

Revision as of 11:13, 15 January 2021

Metabolite CPD-15699

  • common-name:
    • aldehydo-l-arabinose
  • smiles:
    • [ch](=o)c(o)c(o)c(o)co
  • inchi-key:
    • pymyphuhkuwmla-vayjurfesa-n
  • molecular-weight:
    • 150.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality