Difference between revisions of "2E-7Z-hexadeca-2-7-dienoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11476 == * transcription-direction: ** negative * right-end-position: ** 234086 * left-end-position: ** 229721 * centisome-position: ** 61.810448...") |
(Created page with "Category:metabolite == Metabolite CPD-19144 == * common-name: ** (7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-19144 == |
− | * | + | * common-name: |
− | ** | + | ** (7z)-hexadecenoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** mjwmoldkmbisob-ydggzukgsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 999.899 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-17779]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-17778]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=(7z)-hexadecenoyl-coa}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=mjwmoldkmbisob-ydggzukgsa-j}} |
− | {{#set: | + | {{#set: molecular-weight=999.899}} |
− | |||
− | {{#set: | ||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-19144
- common-name:
- (7z)-hexadecenoyl-coa
- smiles:
- ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- mjwmoldkmbisob-ydggzukgsa-j
- molecular-weight:
- 999.899