Difference between revisions of "2E-7Z-hexadeca-2-7-dienoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...")
(Created page with "Category:metabolite == Metabolite CPD-17492 == * common-name: ** (r)-2-hydroxy-4-methylpentanoate * smiles: ** cc(c)cc(c([o-])=o)o * inchi-key: ** lvrftazaxqpqhi-rxmqykeds...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12461 ==
+
== Metabolite CPD-17492 ==
 +
* common-name:
 +
** (r)-2-hydroxy-4-methylpentanoate
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
+
** cc(c)cc(c([o-])=o)o
* common-name:
+
* inchi-key:
** tri-trans,hepta-cis-undecaprenyl diphosphate
+
** lvrftazaxqpqhi-rxmqykedsa-m
 
* molecular-weight:
 
* molecular-weight:
** 924.251
+
** 131.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11488]]
+
* [[RXN-17525]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}}
+
{{#set: common-name=(r)-2-hydroxy-4-methylpentanoate}}
{{#set: molecular-weight=924.251}}
+
{{#set: inchi-key=inchikey=lvrftazaxqpqhi-rxmqykedsa-m}}
 +
{{#set: molecular-weight=131.151}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-17492

  • common-name:
    • (r)-2-hydroxy-4-methylpentanoate
  • smiles:
    • cc(c)cc(c([o-])=o)o
  • inchi-key:
    • lvrftazaxqpqhi-rxmqykedsa-m
  • molecular-weight:
    • 131.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality