Difference between revisions of "2E-7Z-hexadeca-2-7-dienoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17492 == * common-name: ** (r)-2-hydroxy-4-methylpentanoate * smiles: ** cc(c)cc(c([o-])=o)o * inchi-key: ** lvrftazaxqpqhi-rxmqykeds...") |
(Created page with "Category:metabolite == Metabolite CPD1F-133 == * common-name: ** violaxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-133 == |
* common-name: | * common-name: | ||
− | ** | + | ** violaxanthin |
* smiles: | * smiles: | ||
− | ** cc(c)cc(c( | + | ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** szcbxwmuopqsox-wvjdlnglsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 600.88 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13185]] | ||
+ | * [[RXN-7984]] | ||
+ | * [[RXN1F-155]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13185]] |
+ | * [[RXN-7979]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=violaxanthin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=szcbxwmuopqsox-wvjdlnglsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=600.88}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD1F-133
- common-name:
- violaxanthin
- smiles:
- cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
- inchi-key:
- szcbxwmuopqsox-wvjdlnglsa-n
- molecular-weight:
- 600.88