Difference between revisions of "2K-ADIPATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Glycerolipid-crepenynate == * common-name: ** a [glycerolipid]-crepenynate == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * smiles: ** c(cc(=o)c(=o)[o-])cc(=o)[o-] * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * mole...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Glycerolipid-crepenynate ==
+
== Metabolite 2K-ADIPATE ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-crepenynate
+
** 2-oxoadipate
 +
* smiles:
 +
** c(cc(=o)c(=o)[o-])cc(=o)[o-]
 +
* inchi-key:
 +
** fgsbnbbhozhubo-uhfffaoysa-l
 +
* molecular-weight:
 +
** 158.11
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.99.33-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-crepenynate}}
+
{{#set: common-name=2-oxoadipate}}
 +
{{#set: inchi-key=inchikey=fgsbnbbhozhubo-uhfffaoysa-l}}
 +
{{#set: molecular-weight=158.11}}

Latest revision as of 11:11, 18 March 2021

Metabolite 2K-ADIPATE

  • common-name:
    • 2-oxoadipate
  • smiles:
    • c(cc(=o)c(=o)[o-])cc(=o)[o-]
  • inchi-key:
    • fgsbnbbhozhubo-uhfffaoysa-l
  • molecular-weight:
    • 158.11

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality