Difference between revisions of "2R-3R-Dihydroflavonols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * smiles: ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o * inchi-key: ** fnzlkvnuwiipsj-uh...")
(Created page with "Category:metabolite == Metabolite CPD-16618 == * common-name: ** l-malic semialdehyde * smiles: ** c(c(=o)[o-])c(o)[ch]=o * inchi-key: ** qwhdxiuuxwgqme-gsvougtgsa-m * mol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBULOSE-5P ==
+
== Metabolite CPD-16618 ==
 
* common-name:
 
* common-name:
** d-ribulose 5-phosphate
+
** l-malic semialdehyde
 
* smiles:
 
* smiles:
** c(c(c(c(co)=o)o)o)op([o-])([o-])=o
+
** c(c(=o)[o-])c(o)[ch]=o
 
* inchi-key:
 
* inchi-key:
** fnzlkvnuwiipsj-uhnvwzdzsa-l
+
** qwhdxiuuxwgqme-gsvougtgsa-m
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 117.081
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIOHBUTANONEPSYN-RXN]]
+
* [[RXN-6002]]
* [[PHOSPHORIBULOKINASE-RXN]]
 
* [[RIB5PISOM-RXN]]
 
* [[RIBULP3EPIM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6PGLUCONDEHYDROG-RXN]]
 
* [[PHOSPHORIBULOKINASE-RXN]]
 
* [[RIB5PISOM-RXN]]
 
* [[RIBULP3EPIM-RXN]]
 
* [[RXN-3341]]
 
* [[RXN-9952]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-ribulose 5-phosphate}}
+
{{#set: common-name=l-malic semialdehyde}}
{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}}
+
{{#set: inchi-key=inchikey=qwhdxiuuxwgqme-gsvougtgsa-m}}
{{#set: molecular-weight=228.095}}
+
{{#set: molecular-weight=117.081}}

Revision as of 11:15, 15 January 2021

Metabolite CPD-16618

  • common-name:
    • l-malic semialdehyde
  • smiles:
    • c(c(=o)[o-])c(o)[ch]=o
  • inchi-key:
    • qwhdxiuuxwgqme-gsvougtgsa-m
  • molecular-weight:
    • 117.081

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality