Difference between revisions of "2R-3R-Dihydroflavonols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19167 == * common-name: ** 3-oxo-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite 2R-3R-Dihydroflavonols == * common-name: ** a (2r,3r)-dihydroflavonol == Reaction(s) known to consume the compound == * RXN-17678 ==...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19167 ==
+
== Metabolite 2R-3R-Dihydroflavonols ==
 
* common-name:
 
* common-name:
** 3-oxo-(7z)-hexadecenoyl-coa
+
** a (2r,3r)-dihydroflavonol
* smiles:
 
** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** bucifqoxnyheoo-ydggzukgsa-j
 
* molecular-weight:
 
** 1013.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17782]]
+
* [[RXN-17678]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17781]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(7z)-hexadecenoyl-coa}}
+
{{#set: common-name=a (2r,3r)-dihydroflavonol}}
{{#set: inchi-key=inchikey=bucifqoxnyheoo-ydggzukgsa-j}}
 
{{#set: molecular-weight=1013.883}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 2R-3R-Dihydroflavonols

  • common-name:
    • a (2r,3r)-dihydroflavonol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality