Difference between revisions of "2R-3R-Dihydroflavonols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * smiles: ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o * inchi-key: ** fnzlkvnuwiipsj-uh...") |
(Created page with "Category:metabolite == Metabolite 2R-3R-Dihydroflavonols == * common-name: ** a (2r,3r)-dihydroflavonol == Reaction(s) known to consume the compound == * RXN-17678 ==...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2R-3R-Dihydroflavonols == |
* common-name: | * common-name: | ||
− | ** | + | ** a (2r,3r)-dihydroflavonol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17678]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a (2r,3r)-dihydroflavonol}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 2R-3R-Dihydroflavonols
- common-name:
- a (2r,3r)-dihydroflavonol