Difference between revisions of "2R-3R-Dihydroflavonols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7535 == * common-name: ** 9,15,9'-tri-cis-ζ-carotene * smiles: ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)...")
(Created page with "Category:metabolite == Metabolite CPD-330 == * common-name: ** l-galactono-1,4-lactone * smiles: ** c(o)c(o)[ch]1(c(o)c(o)c(=o)o1) * inchi-key: ** sxzycxmupbbulw-neewwzbls...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7535 ==
+
== Metabolite CPD-330 ==
 
* common-name:
 
* common-name:
** 9,15,9'-tri-cis-ζ-carotene
+
** l-galactono-1,4-lactone
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
+
** c(o)c(o)[ch]1(c(o)c(o)c(=o)o1)
 
* inchi-key:
 
* inchi-key:
** biwlelkafxrpde-lmarsqgmsa-n
+
** sxzycxmupbbulw-neewwzblsa-n
 
* molecular-weight:
 
* molecular-weight:
** 540.914
+
** 178.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11354]]
+
* [[1.3.3.12-RXN]]
 +
* [[RXN-11153]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11354]]
+
* [[RXN-1884]]
* [[RXN-11355]]
 
* [[RXN-12244]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9,15,9'-tri-cis-ζ-carotene}}
+
{{#set: common-name=l-galactono-1,4-lactone}}
{{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}}
+
{{#set: inchi-key=inchikey=sxzycxmupbbulw-neewwzblsa-n}}
{{#set: molecular-weight=540.914}}
+
{{#set: molecular-weight=178.141}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-330

  • common-name:
    • l-galactono-1,4-lactone
  • smiles:
    • c(o)c(o)[ch]1(c(o)c(o)c(=o)o1)
  • inchi-key:
    • sxzycxmupbbulw-neewwzblsa-n
  • molecular-weight:
    • 178.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality