Difference between revisions of "2R-3R-Dihydroflavonols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Aldoses == * common-name: ** an aldose == Reaction(s) known to consume the compound == * ALDEHYDE-REDUCTASE-RXN == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * smiles: ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o * inchi-key: ** fnzlkvnuwiipsj-uh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RIBULOSE-5P == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-ribulose 5-phosphate |
| + | * smiles: | ||
| + | ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o | ||
| + | * inchi-key: | ||
| + | ** fnzlkvnuwiipsj-uhnvwzdzsa-l | ||
| + | * molecular-weight: | ||
| + | ** 228.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIOHBUTANONEPSYN-RXN]] |
| + | * [[PHOSPHORIBULOKINASE-RXN]] | ||
| + | * [[RIB5PISOM-RXN]] | ||
| + | * [[RIBULP3EPIM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[6PGLUCONDEHYDROG-RXN]] |
| − | * [[RXN- | + | * [[PHOSPHORIBULOKINASE-RXN]] |
| + | * [[RIB5PISOM-RXN]] | ||
| + | * [[RIBULP3EPIM-RXN]] | ||
| + | * [[RXN-3341]] | ||
| + | * [[RXN-9952]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-ribulose 5-phosphate}} |
| + | {{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}} | ||
| + | {{#set: molecular-weight=228.095}} | ||
Revision as of 18:54, 14 January 2021
Contents
Metabolite RIBULOSE-5P
- common-name:
- d-ribulose 5-phosphate
- smiles:
- c(c(c(c(co)=o)o)o)op([o-])([o-])=o
- inchi-key:
- fnzlkvnuwiipsj-uhnvwzdzsa-l
- molecular-weight:
- 228.095
