Difference between revisions of "3-5-ADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Disulfides == * common-name: ** a protein disulfide == Reaction(s) known to consume the compound == * 1.6.4.4-RXN * HDS =...")
(Created page with "Category:metabolite == Metabolite 3-5-ADP == * common-name: ** adenosine 3',5'-bisphosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-Disulfides ==
+
== Metabolite 3-5-ADP ==
 
* common-name:
 
* common-name:
** a protein disulfide
+
** adenosine 3',5'-bisphosphate
 +
* smiles:
 +
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o-])([o-])=o
 +
* inchi-key:
 +
** whtcpdaxwfldih-kqynxxcusa-j
 +
* molecular-weight:
 +
** 423.172
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.6.4.4-RXN]]
+
* [[1.8.4.8-RXN]]
* [[HDS]]
+
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
 +
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 +
* [[PAPSPAPthr]]
 +
* [[RXN-10994]]
 +
* [[RXN-15587]]
 +
* [[RXN-15588]]
 +
* [[RXN-15589]]
 +
* [[RXN-16759]]
 +
* [[RXN-17203]]
 +
* [[RXN-701]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.11.1.15-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[1.6.4.4-RXN]]
+
* [[1.8.4.8-RXN]]
* [[HDS]]
+
* [[2.8.2.23-RXN]]
 +
* [[2.8.2.29-RXN]]
 +
* [[2.8.2.30-RXN]]
 +
* [[ARYL-SULFOTRANSFERASE-RXN]]
 +
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 +
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
 +
* [[ENTDB-RXN]]
 +
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 +
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
 +
* [[HOLO-ACP-SYNTH-RXN]]
 +
* [[PAPSPAPthr]]
 +
* [[RXN-10614]]
 +
* [[RXN-10615]]
 +
* [[RXN-10777]]
 +
* [[RXN-10782]]
 +
* [[RXN-10994]]
 +
* [[RXN-11058]]
 +
* [[RXN-11059]]
 +
* [[RXN-11555]]
 +
* [[RXN-15587]]
 +
* [[RXN-15588]]
 +
* [[RXN-15589]]
 +
* [[RXN-15889]]
 +
* [[RXN-16759]]
 +
* [[RXN-17203]]
 +
* [[RXN-18301]]
 +
* [[RXN-18303]]
 +
* [[RXN-701]]
 +
* [[RXN-7953]]
 +
* [[RXN-7954]]
 +
* [[RXN6666-9]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a protein disulfide}}
+
{{#set: common-name=adenosine 3',5'-bisphosphate}}
 +
{{#set: inchi-key=inchikey=whtcpdaxwfldih-kqynxxcusa-j}}
 +
{{#set: molecular-weight=423.172}}

Latest revision as of 11:17, 18 March 2021