Difference between revisions of "3-5-ADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7192 RXN0-7192] == * direction: ** left-to-right * common-name: ** biotin-atp ligase * ec-numb...")
(Created page with "Category:metabolite == Metabolite 3-5-ADP == * common-name: ** adenosine 3',5'-bisphosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7192 RXN0-7192] ==
+
== Metabolite 3-5-ADP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** biotin-atp ligase
+
** adenosine 3',5'-bisphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.3.4.15 ec-6.3.4.15]
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o-])([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[BIOTIN]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[BIO-5-AMP]][c] '''+''' 1 [[PPI]][c]
+
** whtcpdaxwfldih-kqynxxcusa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06657]]
+
** 423.172
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[1.8.4.8-RXN]]
−
* Gene: [[SJ07132]]
+
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
−
** Category: [[orthology]]
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PAPSPAPthr]]
−
* Gene: [[SJ19949]]
+
* [[RXN-10994]]
−
** Category: [[orthology]]
+
* [[RXN-15587]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-15588]]
−
* Gene: [[SJ10816]]
+
* [[RXN-15589]]
−
** Category: [[annotation]]
+
* [[RXN-16759]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-17203]]
−
** Category: [[orthology]]
+
* [[RXN-701]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s)  ==
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
== Reconstruction information  ==
+
* [[1.8.4.8-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[2.8.2.23-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.8.2.29-RXN]]
−
== External links  ==
+
* [[2.8.2.30-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[ARYL-SULFOTRANSFERASE-RXN]]
−
{{#set: common-name=biotin-atp ligase}}
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
−
{{#set: ec-number=ec-6.3.4.15}}
+
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
−
{{#set: nb gene associated=4}}
+
* [[ENTDB-RXN]]
−
{{#set: nb pathway associated=0}}
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
−
{{#set: reconstruction category=annotation|orthology}}
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
* [[HOLO-ACP-SYNTH-RXN]]
−
{{#set: reconstruction comment=n.a}}
+
* [[PAPSPAPthr]]
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
+
* [[RXN-10614]]
 +
* [[RXN-10615]]
 +
* [[RXN-10777]]
 +
* [[RXN-10782]]
 +
* [[RXN-10994]]
 +
* [[RXN-11058]]
 +
* [[RXN-11059]]
 +
* [[RXN-11555]]
 +
* [[RXN-15587]]
 +
* [[RXN-15588]]
 +
* [[RXN-15589]]
 +
* [[RXN-15889]]
 +
* [[RXN-16759]]
 +
* [[RXN-17203]]
 +
* [[RXN-18301]]
 +
* [[RXN-18303]]
 +
* [[RXN-701]]
 +
* [[RXN-7953]]
 +
* [[RXN-7954]]
 +
* [[RXN6666-9]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=adenosine 3',5'-bisphosphate}}
 +
{{#set: inchi-key=inchikey=whtcpdaxwfldih-kqynxxcusa-j}}
 +
{{#set: molecular-weight=423.172}}

Latest revision as of 11:17, 18 March 2021

Metabolite 3-5-ADP

  • common-name:
    • adenosine 3',5'-bisphosphate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o-])([o-])=o
  • inchi-key:
    • whtcpdaxwfldih-kqynxxcusa-j
  • molecular-weight:
    • 423.172

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-5-ADP&oldid=139418"