Difference between revisions of "3-BETA-D-GLUCOSYLGLUCOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18762 == * common-name: ** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide * smiles...") |
(Created page with "Category:metabolite == Metabolite 3-BETA-D-GLUCOSYLGLUCOSE == * common-name: ** nigerose * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2) * inchi-key: ** qig...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-BETA-D-GLUCOSYLGLUCOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** nigerose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qigjyvcqydkydw-nsyytrpssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 342.299 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5395]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nigerose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qigjyvcqydkydw-nsyytrpssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=342.299}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 3-BETA-D-GLUCOSYLGLUCOSE
- common-name:
- nigerose
- smiles:
- c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2)
- inchi-key:
- qigjyvcqydkydw-nsyytrpssa-n
- molecular-weight:
- 342.299
