Difference between revisions of "3-BETA-HYDROXYANDROST-5-EN-17-ONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2...")
(Created page with "Category:metabolite == Metabolite 3-BETA-HYDROXYANDROST-5-EN-17-ONE == * common-name: ** 3-β-hydroxyandrost-5-en-17-one * smiles: ** cc24(ccc(o)cc(=cc[ch]1([ch]3(ccc(...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GUANOSINE-5DP-3DP ==
+
== Metabolite 3-BETA-HYDROXYANDROST-5-EN-17-ONE ==
 
* common-name:
 
* common-name:
** ppgpp
+
** 3-β-hydroxyandrost-5-en-17-one
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** cc24(ccc(o)cc(=cc[ch]1([ch]3(ccc(=o)c(cc[ch]12)(c)3)))4)
 
* inchi-key:
 
* inchi-key:
** bufllcufnheseh-uuokfmhzsa-i
+
** fmgsklzlmkygdp-usoajaoksa-n
 
* molecular-weight:
 
* molecular-weight:
** 598.123
+
** 288.429
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GBDP]]
+
* [[RXN66-342]]
* [[PPGPPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GBDP]]
+
* [[RXN66-342]]
* [[GDPPYPHOSKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ppgpp}}
+
{{#set: common-name=3-β-hydroxyandrost-5-en-17-one}}
{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
+
{{#set: inchi-key=inchikey=fmgsklzlmkygdp-usoajaoksa-n}}
{{#set: molecular-weight=598.123}}
+
{{#set: molecular-weight=288.429}}

Latest revision as of 11:15, 18 March 2021

Metabolite 3-BETA-HYDROXYANDROST-5-EN-17-ONE

  • common-name:
    • 3-β-hydroxyandrost-5-en-17-one
  • smiles:
    • cc24(ccc(o)cc(=cc[ch]1([ch]3(ccc(=o)c(cc[ch]12)(c)3)))4)
  • inchi-key:
    • fmgsklzlmkygdp-usoajaoksa-n
  • molecular-weight:
    • 288.429

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality