Difference between revisions of "3-Beta-Hydroxysterols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13187 == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)...")
(Created page with "Category:metabolite == Metabolite 3-Beta-Hydroxysterols == * common-name: ** a 3β-hydroxysteroid == Reaction(s) known to consume the compound == * RXN-13686 == Re...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13187 ==
+
== Metabolite 3-Beta-Hydroxysterols ==
 
* common-name:
 
* common-name:
** unsaturated gellan tetrasaccharide
+
** a 3β-hydroxysteroid
* smiles:
 
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
 
* inchi-key:
 
** jmdplhpaglyhci-pqvubfrasa-m
 
* molecular-weight:
 
** 645.544
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12270]]
+
* [[RXN-13686]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13686]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=unsaturated gellan tetrasaccharide}}
+
{{#set: common-name=a 3β-hydroxysteroid}}
{{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}}
 
{{#set: molecular-weight=645.544}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 3-Beta-Hydroxysterols

  • common-name:
    • a 3β-hydroxysteroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality