Difference between revisions of "3-Beta-Hydroxysterols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13187 == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)...")
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)[o-] * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * mole...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-13187 ==
+
== Metabolite L-ASPARTATE ==
 
* common-name:
 
* common-name:
−
** unsaturated gellan tetrasaccharide
+
** l-aspartate
 
* smiles:
 
* smiles:
−
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
+
** c(c(=o)[o-])c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
−
** jmdplhpaglyhci-pqvubfrasa-m
+
** ckljmwtzizzhcs-reohclbhsa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 645.544
+
** 132.096
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12270]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 +
* [[ARGSUCCINSYN-RXN]]
 +
* [[ASNSYNA-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ASPCARBTRANS-RXN]]
 +
* [[L-ASPARTATE-OXID-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 +
* [[RXN-10]]
 +
* [[RXN-13697]]
 +
* [[RXN-9772]]
 +
* [[SAICARSYN-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.11.21-RXN]]
 +
* [[3.5.1.26-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[ASPARAGHYD-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ASPCARBTRANS-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN0-6975]]
 +
* [[RXN0-6987]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=unsaturated gellan tetrasaccharide}}
+
{{#set: common-name=l-aspartate}}
−
{{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}}
+
{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}
−
{{#set: molecular-weight=645.544}}
+
{{#set: molecular-weight=132.096}}

Revision as of 13:08, 14 January 2021

Metabolite L-ASPARTATE

  • common-name:
    • l-aspartate
  • smiles:
    • c(c(=o)[o-])c([n+])c(=o)[o-]
  • inchi-key:
    • ckljmwtzizzhcs-reohclbhsa-m
  • molecular-weight:
    • 132.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-Beta-Hydroxysterols&oldid=85274"