Difference between revisions of "3-DEHYDRO-SHIKIMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16374 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-8443 ** Category:...")
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * smiles: ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) * inchi-key: ** slwwjzmphjjoph-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16374 ==
+
== Metabolite 3-DEHYDRO-SHIKIMATE ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** 3-dehydroshikimate
== Reaction(s) associated ==
+
* smiles:
* [[RXN-8443]]
+
** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** slwwjzmphjjoph-phdidxhhsa-m
== Pathway(s) associated ==
+
* molecular-weight:
* [[PWY-5381]]
+
** 171.129
** '''6''' reactions found over '''11''' reactions in the full pathway
+
== Reaction(s) known to consume the compound ==
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
{{#set: nb reaction associated=1}}
+
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
{{#set: nb pathway associated=1}}
+
== Reaction(s) known to produce the compound ==
 +
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
 +
* [[RXN-7968]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3-dehydroshikimate}}
 +
{{#set: inchi-key=inchikey=slwwjzmphjjoph-phdidxhhsa-m}}
 +
{{#set: molecular-weight=171.129}}

Latest revision as of 11:14, 18 March 2021

Metabolite 3-DEHYDRO-SHIKIMATE

  • common-name:
    • 3-dehydroshikimate
  • smiles:
    • c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
  • inchi-key:
    • slwwjzmphjjoph-phdidxhhsa-m
  • molecular-weight:
    • 171.129

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality