Difference between revisions of "3-DEHYDRO-SHIKIMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN] == * direction: ** left-...")
(Created page with "Category:metabolite == Metabolite CPD-19726 == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN] ==
+
== Metabolite CPD-19726 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (4s)-2,3-dehydro-leucocyanidin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1.152 ec-2.4.1.152]
+
** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[B-Gal-14-NacGlc-R]][c] '''+''' 1 [[CPD-13118]][c] '''=>''' 1 [[CPD-8594]][c] '''+''' 1 [[GDP]][c] '''+''' 1 [[PROTON]][c]
+
** yaagnrwejszflv-zdusscgksa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06688]]
+
** 304.256
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-602]]
−
* [[PWY-7831]], ABH and Lewis epitopes biosynthesis from type 2 precursor disaccharide: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7831 PWY-7831]
+
== Reaction(s) of unknown directionality ==
−
** '''2''' reactions found over '''11''' reactions in the full pathway
+
{{#set: common-name=(4s)-2,3-dehydro-leucocyanidin}}
−
* [[PWY-7833]], biosynthesis of Lewis epitopes (H. pylori): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7833 PWY-7833]
+
{{#set: inchi-key=inchikey=yaagnrwejszflv-zdusscgksa-n}}
−
** '''2''' reactions found over '''9''' reactions in the full pathway
+
{{#set: molecular-weight=304.256}}
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03519 R03519]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.4.1.152}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-19726

  • common-name:
    • (4s)-2,3-dehydro-leucocyanidin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
  • inchi-key:
    • yaagnrwejszflv-zdusscgksa-n
  • molecular-weight:
    • 304.256

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-DEHYDRO-SHIKIMATE&oldid=47124"