Difference between revisions of "3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * smiles: ** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-ACETO-ACETYL-COA == * common-name: ** 2-methylacetoacetyl-coa * smiles: ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite COPROPORPHYRINOGEN_III ==
+
== Metabolite 2-METHYL-ACETO-ACETYL-COA ==
 
* common-name:
 
* common-name:
** coproporphyrinogen iii
+
** 2-methylacetoacetyl-coa
 
* smiles:
 
* smiles:
** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
+
** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
 
* inchi-key:
 
* inchi-key:
** niuvhxtxuxofeb-uhfffaoysa-j
+
** nhnodhrscralbf-nqnbqjknsa-j
 
* molecular-weight:
 
* molecular-weight:
** 656.734
+
** 861.604
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HEMN-RXN]]
+
* [[1.1.1.178-RXN]]
* [[RXN-17517]]
+
* [[ACCAT]]
* [[RXN0-1461]]
+
* [[HMNOS]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROGENDECARBOX-RXN]]
+
* [[1.1.1.178-RXN]]
 +
* [[HMNOS]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrinogen iii}}
+
{{#set: common-name=2-methylacetoacetyl-coa}}
{{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}}
+
{{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}}
{{#set: molecular-weight=656.734}}
+
{{#set: molecular-weight=861.604}}

Revision as of 18:56, 14 January 2021

Metabolite 2-METHYL-ACETO-ACETYL-COA

  • common-name:
    • 2-methylacetoacetyl-coa
  • smiles:
    • cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
  • inchi-key:
    • nhnodhrscralbf-nqnbqjknsa-j
  • molecular-weight:
    • 861.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality