Difference between revisions of "3-ENOLPYRUVYL-SHIKIMATE-5P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-731 == * common-name: ** (+)-7-epi-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o) * inchi-key: ** znjfbwydhiglcu-qkmqqoolsa-m *...") |
(Created page with "Category:metabolite == Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P == * common-name: ** 5-enolpyruvoyl-shikimate 3-phosphate * smiles: ** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-enolpyruvoyl-shikimate 3-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qutykixiudqolk-prjmdxoysa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 320.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.5.1.19-RXN]] | ||
| + | * [[CHORISMATE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.5.1.19-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-enolpyruvoyl-shikimate 3-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qutykixiudqolk-prjmdxoysa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=320.149}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P
- common-name:
- 5-enolpyruvoyl-shikimate 3-phosphate
- smiles:
- c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
- inchi-key:
- qutykixiudqolk-prjmdxoysa-j
- molecular-weight:
- 320.149
