Difference between revisions of "3-ENOLPYRUVYL-SHIKIMATE-5P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6991 == * common-name: ** (2s)-pinocembrin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3) * inchi-key: ** urfcjeuyxna...") |
(Created page with "Category:metabolite == Metabolite CPD-731 == * common-name: ** (+)-7-epi-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o) * inchi-key: ** znjfbwydhiglcu-qkmqqoolsa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-731 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (+)-7-epi-jasmonate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc1(c(=o)ccc1cc([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** znjfbwydhiglcu-qkmqqoolsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 209.264 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10708]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(+)-7-epi-jasmonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=znjfbwydhiglcu-qkmqqoolsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=209.264}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-731
- common-name:
- (+)-7-epi-jasmonate
- smiles:
- ccc=ccc1(c(=o)ccc1cc([o-])=o)
- inchi-key:
- znjfbwydhiglcu-qkmqqoolsa-m
- molecular-weight:
- 209.264
