Difference between revisions of "3-ENOLPYRUVYL-SHIKIMATE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10458 == * transcription-direction: ** negative * right-end-position: ** 388083 * left-end-position: ** 375378 * centisome-position: ** 96.04587...")
(Created page with "Category:metabolite == Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P == * common-name: ** 5-enolpyruvoyl-shikimate 3-phosphate * smiles: ** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10458 ==
+
== Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P ==
* transcription-direction:
+
* common-name:
** negative
+
** 5-enolpyruvoyl-shikimate 3-phosphate
* right-end-position:
+
* smiles:
** 388083
+
** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
* left-end-position:
+
* inchi-key:
** 375378
+
** qutykixiudqolk-prjmdxoysa-j
* centisome-position:
+
* molecular-weight:
** 96.04587   
+
** 320.149
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[2.5.1.19-RXN]]
== Reaction(s) associated ==
+
* [[CHORISMATE-SYNTHASE-RXN]]
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[2.5.1.19-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=5-enolpyruvoyl-shikimate 3-phosphate}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=qutykixiudqolk-prjmdxoysa-j}}
== Pathway(s) associated ==
+
{{#set: molecular-weight=320.149}}
* [[PWY66-301]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=388083}}
 
{{#set: left-end-position=375378}}
 
{{#set: centisome-position=96.04587    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P

  • common-name:
    • 5-enolpyruvoyl-shikimate 3-phosphate
  • smiles:
    • c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • qutykixiudqolk-prjmdxoysa-j
  • molecular-weight:
    • 320.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality