|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ02279 == | + | == Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate |
| − | * right-end-position:
| + | * smiles: |
| − | ** 97684
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 80393
| + | ** yszsvgfmajxgmq-fricuitqsa-m |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 57.882084 | + | ** 575.85 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) associated == | + | * [[2.1.1.114-RXN]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[PHOSMANMUT-RXN]] | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=yszsvgfmajxgmq-fricuitqsa-m}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=575.85}} |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[PHOSPHOGLUCMUT-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-16997]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-16998]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-5659]]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7456]] | |
| − | ** '''2''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7586]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-882]]
| |
| − | ** '''6''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6737]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7238]]
| |
| − | ** '''5''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[GLYCOGENSYNTH-PWY]]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[GLUCOSE1PMETAB-PWY]]
| |
| − | ** '''3''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7900]]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6731]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-5941]]
| |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[GLYCOCAT-PWY]]
| |
| − | ** '''6''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-622]]
| |
| − | ** '''2''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-6317]]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-2723]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-3801]]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7343]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5940]]
| |
| − | ** '''2''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY-7902]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5384]]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-5661]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY66-422]]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}}
| |
| − | {{#set: right-end-position=97684}} | |
| − | {{#set: left-end-position=80393}}
| |
| − | {{#set: centisome-position=57.882084 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=4}}
| |
| − | {{#set: nb pathway associated=22}}
| |
